ChemNet > CAS > 4923-87-9;133150-64-8 5-Bromobenzo[b]thiophene
4923-87-9;133150-64-8 5-Bromobenzo[b]thiophene
Ürün Adı |
5-Bromobenzo[b]thiophene |
Eş anlamlı |
5-Bromothianaphthene; 5-bromo-1-benzothiophene; 5-Bromobenzo[b]thioophene; 5-Bromobenzothiophene; ; BUTTPARK 98\04-80; Benzo[c]thiophene, 5-bromo- |
Moleküler Formülü |
C8H5BrS |
Molekül Ağırlığı |
213.0943 |
InChI |
InChI=1/C8H5BrS/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5H |
CAS kayıt numarası |
4923-87-9;133150-64-8 |
Moleküler Yapısı |
|
Yoğunluk |
1.649g/cm3 |
Ergime noktası |
46℃ |
Kaynama noktası |
284.7°C at 760 mmHg |
Kırılma indisi |
1.704 |
Alevlenme noktası |
126°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|